CAS 1097732-13-2 is the registry number for 4-(2-Oxo-1,3-oxazolidin-3-yl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonyl chloride (CAS 1097732-13-2) is a chemical compound with the molecular formula C9H8ClNO4S and a molecular weight of 261.68 g/mol. IUPAC name: 4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonyl chloride. InChIKey: JDBPBDWKAGOTFL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4S |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonyl chloride |
| InChIKey | JDBPBDWKAGOTFL-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)