Products 1097732-13-2

CAS 1097732-13-2 is the registry number for 4-(2-Oxo-1,3-oxazolidin-3-yl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonyl chloride (CAS 1097732-13-2) is a chemical compound with the molecular formula C9H8ClNO4S and a molecular weight of 261.68 g/mol. IUPAC name: 4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonyl chloride. InChIKey: JDBPBDWKAGOTFL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO4S
Molecular weight261.68 g/mol
IUPAC name4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonyl chloride
InChIKeyJDBPBDWKAGOTFL-UHFFFAOYSA-N
SMILESC1COC(=O)N1C2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)