CAS 27320-81-6 is the registry number for 4-Methyl-3-oxo-3,4-dihydro-2H-benzo[1,4]oxazine-6-sulfonyl chloride, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
4-methyl-3-oxo-1,4-benzoxazine-6-sulfonyl chloride (CAS 27320-81-6) is a chemical compound with the molecular formula C9H8ClNO4S and a molecular weight of 261.68 g/mol. IUPAC name: 4-methyl-3-oxo-1,4-benzoxazine-6-sulfonyl chloride. InChIKey: LOHFNICBPOJDJL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4S |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 4-methyl-3-oxo-1,4-benzoxazine-6-sulfonyl chloride |
| InChIKey | LOHFNICBPOJDJL-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)