CAS 1097788-45-8 is the registry number for 1-((4-Chloro-3-nitrophenyl)methyl)pyrrolidine-2,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[(4-chloro-3-nitrophenyl)methyl]pyrrolidine-2,5-dione (CAS 1097788-45-8) is a chemical compound with the molecular formula C11H9ClN2O4 and a molecular weight of 268.65 g/mol. IUPAC name: 1-[(4-chloro-3-nitrophenyl)methyl]pyrrolidine-2,5-dione. InChIKey: KRTVEUXHLKRIJA-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O4 |
|---|---|
| Molecular weight | 268.65 g/mol |
| IUPAC name | 1-[(4-chloro-3-nitrophenyl)methyl]pyrrolidine-2,5-dione |
| InChIKey | KRTVEUXHLKRIJA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)CC2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)