CAS 2377645-90-2 appears in our catalog under these names: 4-Chloro-3-(2,4-dioxotetrahydropyrimidin-1(2H)-yl)benzoic acid, 98%, 98%, 4-Chloro-3-(2,4-dioxotetrahydropyrimidin-1(2H)-yl)benzoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzoic acid (CAS 2377645-90-2) is a chemical compound with the molecular formula C11H9ClN2O4 and a molecular weight of 268.65 g/mol. IUPAC name: 4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzoic acid. InChIKey: KYEDERIYNVEFGP-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O4 |
|---|---|
| Molecular weight | 268.65 g/mol |
| IUPAC name | 4-chloro-3-(2,4-dioxo-1,3-diazinan-1-yl)benzoic acid |
| InChIKey | KYEDERIYNVEFGP-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)