CAS 1097825-87-0 appears in our catalog under these names: 2-Bromo-N-((4-methoxyphenyl)methyl)-N,3-dimethylbutanamide, 95%, 2-Bromo-N-((4-methoxyphenyl)methyl)-N,3-dimethylbutanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-bromo-N-[(4-methoxyphenyl)methyl]-N,3-dimethylbutanamide (CAS 1097825-87-0) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: 2-bromo-N-[(4-methoxyphenyl)methyl]-N,3-dimethylbutanamide. InChIKey: NIFDCHXVLWHXPZ-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | 2-bromo-N-[(4-methoxyphenyl)methyl]-N,3-dimethylbutanamide |
| InChIKey | NIFDCHXVLWHXPZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)N(C)CC1=CC=C(C=C1)OC)Br |
Computed by PubChem (NCBI)