CAS 1375931-12-6 is the registry number for 2-Bromo-5-methoxy-N,N-bis(1-methylethyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-bromo-5-methoxy-N,N-di(propan-2-yl)benzamide (CAS 1375931-12-6) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: 2-bromo-5-methoxy-N,N-di(propan-2-yl)benzamide. InChIKey: APKGXNJDGJUQMD-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | 2-bromo-5-methoxy-N,N-di(propan-2-yl)benzamide |
| InChIKey | APKGXNJDGJUQMD-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=C(C=CC(=C1)OC)Br |
Computed by PubChem (NCBI)