CAS 109810-81-3 appears in our catalog under these names: Bisacodyl Impurity 2, Picosulfate Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(4-hydroxyphenyl)-pyridin-4-ylmethyl]phenol (CAS 109810-81-3) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)-pyridin-4-ylmethyl]phenol. InChIKey: HRQXTHWSVIKOLP-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)-pyridin-4-ylmethyl]phenol |
| InChIKey | HRQXTHWSVIKOLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C3=CC=NC=C3)O |
Computed by PubChem (NCBI)