CAS 1098100-07-2 is the registry number for (R)-2-(2-Chlorophenyl)-2-(2-phenylacetamido)acetic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-(2-chlorophenyl)-2-[(2-phenylacetyl)amino]acetic acid (CAS 1098100-07-2) is a chemical compound with the molecular formula C16H14ClNO3 and a molecular weight of 303.74 g/mol. IUPAC name: (2R)-2-(2-chlorophenyl)-2-[(2-phenylacetyl)amino]acetic acid. InChIKey: MTFPCYJZWDSFOB-OAHLLOKOSA-N.
| Molecular formula | C16H14ClNO3 |
|---|---|
| Molecular weight | 303.74 g/mol |
| IUPAC name | (2R)-2-(2-chlorophenyl)-2-[(2-phenylacetyl)amino]acetic acid |
| InChIKey | MTFPCYJZWDSFOB-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)N[C@H](C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)