CAS 1160264-17-4 appears in our catalog under these names: 2-(4-Chlorophenyl)-1-methyl-2-oxoethyl 4-aminobenzoate, 95%, 1-(4-Chlorophenyl)-1-oxopropan-2-yl 4-aminobenzoate, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
[1-(4-chlorophenyl)-1-oxopropan-2-yl] 4-aminobenzoate (CAS 1160264-17-4) is a chemical compound with the molecular formula C16H14ClNO3 and a molecular weight of 303.74 g/mol. IUPAC name: [1-(4-chlorophenyl)-1-oxopropan-2-yl] 4-aminobenzoate. InChIKey: SVVXUELLJUNPJJ-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO3 |
|---|---|
| Molecular weight | 303.74 g/mol |
| IUPAC name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 4-aminobenzoate |
| InChIKey | SVVXUELLJUNPJJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Cl)OC(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)