Products 1629857-90-4

CAS 1629857-90-4 is the registry number for 2-[(4-Chlorobenzoyl)amino]-3-phenylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[(4-chlorobenzoyl)amino]-3-phenylpropanoic acid (CAS 1629857-90-4) is a chemical compound with the molecular formula C16H14ClNO3 and a molecular weight of 303.74 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]-3-phenylpropanoic acid. InChIKey: QEVZJOOFVAMXKO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14ClNO3
Molecular weight303.74 g/mol
IUPAC name2-[(4-chlorobenzoyl)amino]-3-phenylpropanoic acid
InChIKeyQEVZJOOFVAMXKO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(C(=O)O)NC(=O)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)