Products 2682114-50-5
CAS 2682114-50-5 appears in our catalog under these names: 4-((4-(Chloromethyl)benzamido)methyl)benzoic acid, 97%, 97%, 4-((4-(Chloromethyl)benzamido)methyl)benzoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
4-[[[4-(chloromethyl)benzoyl]amino]methyl]benzoic acid (CAS 2682114-50-5) is a chemical compound with the molecular formula C16H14ClNO3 and a molecular weight of 303.74 g/mol. IUPAC name: 4-[[[4-(chloromethyl)benzoyl]amino]methyl]benzoic acid. InChIKey: LTACGWRODQYXMQ-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO3 |
|---|---|
| Molecular weight | 303.74 g/mol |
| IUPAC name | 4-[[[4-(chloromethyl)benzoyl]amino]methyl]benzoic acid |
| InChIKey | LTACGWRODQYXMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=O)C2=CC=C(C=C2)CCl)C(=O)O |
Computed by PubChem (NCBI)