CAS 571157-73-8 is the registry number for 2-Chloro-N-(2-methoxydibenzo(b,d)furan-3-yl)propanamide, 98%. Offered by: AmBeed. Available pack sizes: 10g.
2-chloro-N-(2-methoxydibenzofuran-3-yl)propanamide (CAS 571157-73-8) is a chemical compound with the molecular formula C16H14ClNO3 and a molecular weight of 303.74 g/mol. IUPAC name: 2-chloro-N-(2-methoxydibenzofuran-3-yl)propanamide. InChIKey: IGYQLHOERAOFJM-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO3 |
|---|---|
| Molecular weight | 303.74 g/mol |
| IUPAC name | 2-chloro-N-(2-methoxydibenzofuran-3-yl)propanamide |
| InChIKey | IGYQLHOERAOFJM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=C2C3=CC=CC=C3OC2=C1)OC)Cl |
Computed by PubChem (NCBI)