CAS 112776-46-2 is the registry number for N-(2H-1,3-Benzodioxol-5-ylmethyl)-2-chloro-2-phenylacetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-2-phenylacetamide (CAS 112776-46-2) is a chemical compound with the molecular formula C16H14ClNO3 and a molecular weight of 303.74 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-2-phenylacetamide. InChIKey: OJNQJEDIWINDEN-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO3 |
|---|---|
| Molecular weight | 303.74 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-2-phenylacetamide |
| InChIKey | OJNQJEDIWINDEN-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC(=O)C(C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)