CAS 1098349-47-3 appears in our catalog under these names: 2-(2-(Furan-2-yl)-1,3-thiazol-4-yl)acetamide, 95%, 2-(2-(Furan-2-yl)-1,3-thiazol-4-yl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide (CAS 1098349-47-3) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide. InChIKey: UFGFDBFEPNOWMT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide |
| InChIKey | UFGFDBFEPNOWMT-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC(=CS2)CC(=O)N |
Computed by PubChem (NCBI)