Products 1098387-29-1

CAS 1098387-29-1 appears in our catalog under these names: 2-Bromo-4-cyanobenzene-1-sulfonyl chloride, 2-Bromo-4-cyanobenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.

2-bromo-4-cyanobenzenesulfonyl chloride (CAS 1098387-29-1) is a chemical compound with the molecular formula C7H3BrClNO2S and a molecular weight of 280.53 g/mol. IUPAC name: 2-bromo-4-cyanobenzenesulfonyl chloride. InChIKey: VQLXVSAILFHTBT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrClNO2S
Molecular weight280.53 g/mol
IUPAC name2-bromo-4-cyanobenzenesulfonyl chloride
InChIKeyVQLXVSAILFHTBT-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C#N)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)