Products 1201684-65-2

CAS 1201684-65-2 is the registry number for 3-Bromo-4-cyanobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-bromo-4-cyanobenzenesulfonyl chloride (CAS 1201684-65-2) is a chemical compound with the molecular formula C7H3BrClNO2S and a molecular weight of 280.53 g/mol. IUPAC name: 3-bromo-4-cyanobenzenesulfonyl chloride. InChIKey: BCIQSKZDKOJPFW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrClNO2S
Molecular weight280.53 g/mol
IUPAC name3-bromo-4-cyanobenzenesulfonyl chloride
InChIKeyBCIQSKZDKOJPFW-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)Br)C#N

Computed by PubChem (NCBI)