Products 431046-20-7
CAS 431046-20-7 appears in our catalog under these names: 4-Bromo-2-cyanobenzene-1-sulfonyl chloride, 95%, 4-Bromo-2-cyanobenzenesulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4-bromo-2-cyanobenzenesulfonyl chloride (CAS 431046-20-7) is a chemical compound with the molecular formula C7H3BrClNO2S and a molecular weight of 280.53 g/mol. IUPAC name: 4-bromo-2-cyanobenzenesulfonyl chloride. InChIKey: UKKDPMZQOAIVAD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO2S |
|---|---|
| Molecular weight | 280.53 g/mol |
| IUPAC name | 4-bromo-2-cyanobenzenesulfonyl chloride |
| InChIKey | UKKDPMZQOAIVAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C#N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)