Products 87476-69-5
CAS 87476-69-5 is the registry number for 6-Bromo-3-chlorobenzo(d)isothiazole 1,1-dioxide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
6-bromo-3-chloro-1,2-benzothiazole 1,1-dioxide (CAS 87476-69-5) is a chemical compound with the molecular formula C7H3BrClNO2S and a molecular weight of 280.53 g/mol. IUPAC name: 6-bromo-3-chloro-1,2-benzothiazole 1,1-dioxide. InChIKey: GCZATFRLSCYOLO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO2S |
|---|---|
| Molecular weight | 280.53 g/mol |
| IUPAC name | 6-bromo-3-chloro-1,2-benzothiazole 1,1-dioxide |
| InChIKey | GCZATFRLSCYOLO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)S(=O)(=O)N=C2Cl |
Computed by PubChem (NCBI)