Products 1257415-88-5
CAS 1257415-88-5 appears in our catalog under these names: 5-BROMO-2-CYANOBENZENESULFONYL CHLORIDE, 98%, 5-Bromo-2-cyanobenzene-1-sulfonyl chloride, 98%, 5-Bromo-2-cyanobenzene-1-sulfonyl chloride, 97%, 97%. Offered by: Fluorochem, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-bromo-2-cyanobenzenesulfonyl chloride (CAS 1257415-88-5) is a chemical compound with the molecular formula C7H3BrClNO2S and a molecular weight of 280.53 g/mol. IUPAC name: 5-bromo-2-cyanobenzenesulfonyl chloride. InChIKey: BPGQSAVORPJKIJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO2S |
|---|---|
| Molecular weight | 280.53 g/mol |
| IUPAC name | 5-bromo-2-cyanobenzenesulfonyl chloride |
| InChIKey | BPGQSAVORPJKIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)