Products 49674-17-1
CAS 49674-17-1 appears in our catalog under these names: 3–Bromo–5–cyanobenzene–1–sulfonyl chloride, 3-Bromo-5-cyanobenzene-1-sulfonyl chloride. Offered by: GLPBio, Biosynth. Available pack sizes: 50mg, 0,5g.
3-bromo-5-cyanobenzenesulfonyl chloride (CAS 49674-17-1) is a chemical compound with the molecular formula C7H3BrClNO2S and a molecular weight of 280.53 g/mol. IUPAC name: 3-bromo-5-cyanobenzenesulfonyl chloride. InChIKey: RDXIVSGVEAXENI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO2S |
|---|---|
| Molecular weight | 280.53 g/mol |
| IUPAC name | 3-bromo-5-cyanobenzenesulfonyl chloride |
| InChIKey | RDXIVSGVEAXENI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)Cl)Br)C#N |
Computed by PubChem (NCBI)