Products 1098617-25-4
CAS 1098617-25-4 is the registry number for (R)-2-Amino-6-(1,3-dioxoisoindolin-2-yl)hexanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-6-(1,3-dioxoisoindol-2-yl)hexanoic acid (CAS 1098617-25-4) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 2-amino-6-(1,3-dioxoisoindol-2-yl)hexanoic acid. InChIKey: WFKJLXBKVVZRLS-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 2-amino-6-(1,3-dioxoisoindol-2-yl)hexanoic acid |
| InChIKey | WFKJLXBKVVZRLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCC(C(=O)O)N |
Computed by PubChem (NCBI)