Products 26502-58-9

CAS 26502-58-9 is the registry number for 1-(4-Ethoxy-phenyl)-4-hydroxy-1h-pyrazole-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 1-(4-ethoxyphenyl)-4-hydroxypyrazole-3-carboxylate (CAS 26502-58-9) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: ethyl 1-(4-ethoxyphenyl)-4-hydroxypyrazole-3-carboxylate. InChIKey: LTNGQELIESBHOI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O4
Molecular weight276.29 g/mol
IUPAC nameethyl 1-(4-ethoxyphenyl)-4-hydroxypyrazole-3-carboxylate
InChIKeyLTNGQELIESBHOI-UHFFFAOYSA-N
SMILESCCOC1=CC=C(C=C1)N2C=C(C(=N2)C(=O)OCC)O

Computed by PubChem (NCBI)