Products 1098620-13-3
CAS 1098620-13-3 is the registry number for Methyl 4-(aminomethyl)-2,6-dichlorobenzoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-(aminomethyl)-2,6-dichlorobenzoate (CAS 1098620-13-3) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: methyl 4-(aminomethyl)-2,6-dichlorobenzoate. InChIKey: OOBNHMAUZUZHHR-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | methyl 4-(aminomethyl)-2,6-dichlorobenzoate |
| InChIKey | OOBNHMAUZUZHHR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)CN)Cl |
Computed by PubChem (NCBI)