CAS 109888-65-5 is the registry number for 3-(4-(Trifluoromethyl)phenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 109888-65-5) is a chemical compound with the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: UYCWRKRHUGMJDH-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO3 |
|---|---|
| Molecular weight | 259.18 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | UYCWRKRHUGMJDH-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC=C(C=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)