CAS 329710-82-9 is the registry number for 2-(2-(Trifluoromethoxy)ethyl)isoindoline-1,3-dione, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-[2-(trifluoromethoxy)ethyl]isoindole-1,3-dione (CAS 329710-82-9) is a chemical compound with the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. IUPAC name: 2-[2-(trifluoromethoxy)ethyl]isoindole-1,3-dione. InChIKey: PSGIEGKGUHUGDF-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO3 |
|---|---|
| Molecular weight | 259.18 g/mol |
| IUPAC name | 2-[2-(trifluoromethoxy)ethyl]isoindole-1,3-dione |
| InChIKey | PSGIEGKGUHUGDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCOC(F)(F)F |
Computed by PubChem (NCBI)