Products 2112439-31-1
CAS 2112439-31-1 is the registry number for Ethyl 6-(trifluoromethyl)benzo[c]isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-(trifluoromethyl)-2,1-benzoxazole-3-carboxylate (CAS 2112439-31-1) is a chemical compound with the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. IUPAC name: ethyl 6-(trifluoromethyl)-2,1-benzoxazole-3-carboxylate. InChIKey: IAIHHBLRAODCKV-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO3 |
|---|---|
| Molecular weight | 259.18 g/mol |
| IUPAC name | ethyl 6-(trifluoromethyl)-2,1-benzoxazole-3-carboxylate |
| InChIKey | IAIHHBLRAODCKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=CC(=CC2=NO1)C(F)(F)F |
Computed by PubChem (NCBI)