CAS 380430-75-1 appears in our catalog under these names: 2-((4,4,4-Trifluoro-3-oxobut-1-en-1-yl)amino)benzoic acid, 2-((4,4,4-Trifluoro-3-oxobut-1-en-1-yl)amino)benzoic acid, 95%, 2-(4,4,4-Trifluoro-3-oxo-but-1-enylamino)-benzoic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 250mg, 1g, 100mg.
2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoic acid (CAS 380430-75-1) is a chemical compound with the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. IUPAC name: 2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoic acid. InChIKey: YQRSWYLDDWXJEQ-AATRIKPKSA-N.
| Molecular formula | C11H8F3NO3 |
|---|---|
| Molecular weight | 259.18 g/mol |
| IUPAC name | 2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoic acid |
| InChIKey | YQRSWYLDDWXJEQ-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N/C=C/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)