CAS 1623766-99-3 is the registry number for 2-(3-Methoxy-4-(trifluoromethyl)phenyl)oxazol-5(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-methoxy-4-(trifluoromethyl)phenyl]-4H-1,3-oxazol-5-one (CAS 1623766-99-3) is a chemical compound with the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. IUPAC name: 2-[3-methoxy-4-(trifluoromethyl)phenyl]-4H-1,3-oxazol-5-one. InChIKey: NNJXBFOTPOMFJX-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO3 |
|---|---|
| Molecular weight | 259.18 g/mol |
| IUPAC name | 2-[3-methoxy-4-(trifluoromethyl)phenyl]-4H-1,3-oxazol-5-one |
| InChIKey | NNJXBFOTPOMFJX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NCC(=O)O2)C(F)(F)F |
Computed by PubChem (NCBI)