CAS 116401-44-6 is the registry number for N-[3-(Trifluoromethyl)phenyl]maleamic acid. Offered by: Fluorochem. Available pack sizes: 1g.
(E)-4-oxo-4-[3-(trifluoromethyl)anilino]but-2-enoic acid (CAS 116401-44-6) is a chemical compound with the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. IUPAC name: (E)-4-oxo-4-[3-(trifluoromethyl)anilino]but-2-enoic acid. InChIKey: XHTHMZFBLNIKJC-SNAWJCMRSA-N.
| Molecular formula | C11H8F3NO3 |
|---|---|
| Molecular weight | 259.18 g/mol |
| IUPAC name | (E)-4-oxo-4-[3-(trifluoromethyl)anilino]but-2-enoic acid |
| InChIKey | XHTHMZFBLNIKJC-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)/C=C/C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)