Products 1099113-52-6

CAS 1099113-52-6 is the registry number for 2-((3-Cyanophenyl)methanesulfonamido)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(3-cyanophenyl)methylsulfonylamino]acetic acid (CAS 1099113-52-6) is a chemical compound with the molecular formula C10H10N2O4S and a molecular weight of 254.26 g/mol. IUPAC name: 2-[(3-cyanophenyl)methylsulfonylamino]acetic acid. InChIKey: UIQJTDHCLLOOFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O4S
Molecular weight254.26 g/mol
IUPAC name2-[(3-cyanophenyl)methylsulfonylamino]acetic acid
InChIKeyUIQJTDHCLLOOFQ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C#N)CS(=O)(=O)NCC(=O)O

Computed by PubChem (NCBI)