Products 1099157-13-7

CAS 1099157-13-7 is the registry number for 3-(2-(2-Fluorophenoxy)acetamido)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[[2-(2-fluorophenoxy)acetyl]amino]propanoic acid (CAS 1099157-13-7) is a chemical compound with the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. IUPAC name: 3-[[2-(2-fluorophenoxy)acetyl]amino]propanoic acid. InChIKey: UZNIBAVNUCZKCS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12FNO4
Molecular weight241.22 g/mol
IUPAC name3-[[2-(2-fluorophenoxy)acetyl]amino]propanoic acid
InChIKeyUZNIBAVNUCZKCS-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)OCC(=O)NCCC(=O)O)F

Computed by PubChem (NCBI)