Products 1332524-02-3
CAS 1332524-02-3 appears in our catalog under these names: Enzalutamide Impurity D, Enzalutamide Impurity 21, 4-((2-Carboxypropan-2-yl)amino)-2-fluorobenzoic acid 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g, 5g, 10g.
4-(2-carboxypropan-2-ylamino)-2-fluorobenzoic acid (CAS 1332524-02-3) is a chemical compound with the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. IUPAC name: 4-(2-carboxypropan-2-ylamino)-2-fluorobenzoic acid. InChIKey: GVMQERXYJLHNIZ-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 4-(2-carboxypropan-2-ylamino)-2-fluorobenzoic acid |
| InChIKey | GVMQERXYJLHNIZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC1=CC(=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
Enzalutamide Impurity D, 4-((2-Carboxypropan-2-yl)amino)-2-fluorobenzoic acid, 4-(2-carboxypropan-2-ylamino)-2-fluorobenzoic acid, 4-[(1-Carboxy-1-methylethyl)amino]-2-fluorobenzoic acid, 4-[(2-Carboxy-2-propyl)amino]-2-fluorobenzoic Acid, Enzalutamide Impurity 6, 4-[(2-Carboxypropan-2-yl)amino]-2-fluorobenzoic acid, (API-ZZJ), 4-(1-carboxy-1-methyl-ethylamino)-2-fluoro-benzoic acid, GVMQERXYJLHNIZ-UHFFFAOYSA-N