Products 210346-38-6
CAS 210346-38-6 appears in our catalog under these names: 4-(4-Fluoro-5-methyl-2-nitrophenyl)butanoic acid, 95%, 4–(4–Fluoro–5–methyl–2–nitrophenyl)butanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-(4-fluoro-5-methyl-2-nitrophenyl)butanoic acid (CAS 210346-38-6) is a chemical compound with the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. IUPAC name: 4-(4-fluoro-5-methyl-2-nitrophenyl)butanoic acid. InChIKey: FLDSODKYHOICTB-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 4-(4-fluoro-5-methyl-2-nitrophenyl)butanoic acid |
| InChIKey | FLDSODKYHOICTB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)[N+](=O)[O-])CCCC(=O)O |
Computed by PubChem (NCBI)