CAS 219858-64-7 appears in our catalog under these names: N-Acetyl-3-fluoro-dl-tyrosine, 97%, 2-Acetamido-3-(3-fluoro-4-hydroxyphenyl)propanoic acid, 97%, 2–ACETYLAMINO–3–(3–FLUORO–4–HYDROXY–PHENYL)–PROPIONIC ACID, N-ACETYL-3-FLUORO-DL-TYROSINE, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-acetamido-3-(3-fluoro-4-hydroxyphenyl)propanoic acid (CAS 219858-64-7) is a chemical compound with the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. IUPAC name: 2-acetamido-3-(3-fluoro-4-hydroxyphenyl)propanoic acid. InChIKey: CEYBRSLAYCIMOV-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 2-acetamido-3-(3-fluoro-4-hydroxyphenyl)propanoic acid |
| InChIKey | CEYBRSLAYCIMOV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CC(=C(C=C1)O)F)C(=O)O |
Computed by PubChem (NCBI)