CAS 157665-46-8 appears in our catalog under these names: 2-Fluoro-4-nitrobenzoic acid t-butyl ester, 95%, tert-Butyl 2-fluoro-4-nitrobenzoate, 97%, 97%, TERT-BUTYL 2-FLUORO-4-NITROBENZOATE, 97%, tert-Butyl 2-fluoro-4-nitrobenzoate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
Tert-butyl 2-fluoro-4-nitrobenzoate (CAS 157665-46-8) is a chemical compound with the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. IUPAC name: tert-butyl 2-fluoro-4-nitrobenzoate. InChIKey: ISOZHNCXGVENLC-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | tert-butyl 2-fluoro-4-nitrobenzoate |
| InChIKey | ISOZHNCXGVENLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)