CAS 526218-22-4 appears in our catalog under these names: 2-Fluoro-5-nitro-benzoic acid tert-butyl ester, 95%, tert-Butyl 2-fluoro-5-nitrobenzoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
Tert-butyl 2-fluoro-5-nitrobenzoate (CAS 526218-22-4) is a chemical compound with the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. IUPAC name: tert-butyl 2-fluoro-5-nitrobenzoate. InChIKey: KTDUZCFVCPSEOM-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | tert-butyl 2-fluoro-5-nitrobenzoate |
| InChIKey | KTDUZCFVCPSEOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)