Products 1099598-23-8
CAS 1099598-23-8 is the registry number for 1-Chloro-2-fluoro-3-(2,2,2-trifluoroethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-chloro-2-fluoro-3-(2,2,2-trifluoroethyl)benzene (CAS 1099598-23-8) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 1-chloro-2-fluoro-3-(2,2,2-trifluoroethyl)benzene. InChIKey: FGUXRTAVYNYNGW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 1-chloro-2-fluoro-3-(2,2,2-trifluoroethyl)benzene |
| InChIKey | FGUXRTAVYNYNGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)CC(F)(F)F |
Computed by PubChem (NCBI)