CAS 1099598-24-9 appears in our catalog under these names: 4-Chloro-1-fluoro-2-(2,2,2-trifluoroethyl)benzene, 95%, 4-Chloro-1-fluoro-2-(2,2,2-trifluoroethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-chloro-1-fluoro-2-(2,2,2-trifluoroethyl)benzene (CAS 1099598-24-9) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 4-chloro-1-fluoro-2-(2,2,2-trifluoroethyl)benzene. InChIKey: HIIQQIYUDSBFOB-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 4-chloro-1-fluoro-2-(2,2,2-trifluoroethyl)benzene |
| InChIKey | HIIQQIYUDSBFOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(F)(F)F)F |
Computed by PubChem (NCBI)