Products 832113-94-7
CAS 832113-94-7 appears in our catalog under these names: 2-Trifluoromethyl-5-fluorobenzyl chloride, 95%, 2-Trifluoromethyl-5-fluorobenzylchloride, 97%, 5-Fluoro-2-trifluoromethylbenzyl chloride, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 1g.
2-(chloromethyl)-4-fluoro-1-(trifluoromethyl)benzene (CAS 832113-94-7) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 2-(chloromethyl)-4-fluoro-1-(trifluoromethyl)benzene. InChIKey: IGURRQIIIXYJND-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 2-(chloromethyl)-4-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | IGURRQIIIXYJND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CCl)C(F)(F)F |
Computed by PubChem (NCBI)