CAS 1000339-60-5 appears in our catalog under these names: 2-Fluoro-4-(trifluoromethyl)benzyl chloride, 98%, 1-(Chloromethyl)-2-fluoro-4-(trifluoromethyl)benzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 25g.
1-(chloromethyl)-2-fluoro-4-(trifluoromethyl)benzene (CAS 1000339-60-5) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 1-(chloromethyl)-2-fluoro-4-(trifluoromethyl)benzene. InChIKey: OOGWHXAQEMXPLR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 1-(chloromethyl)-2-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | OOGWHXAQEMXPLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)CCl |
Computed by PubChem (NCBI)