Products 1138444-89-9
CAS 1138444-89-9 is the registry number for 1-Chloro-4-(1,1-difluoroethyl)-2,5-difluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-chloro-4-(1,1-difluoroethyl)-2,5-difluorobenzene (CAS 1138444-89-9) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 1-chloro-4-(1,1-difluoroethyl)-2,5-difluorobenzene. InChIKey: UBHFMVSDUWNDCM-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 1-chloro-4-(1,1-difluoroethyl)-2,5-difluorobenzene |
| InChIKey | UBHFMVSDUWNDCM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1F)Cl)F)(F)F |
Computed by PubChem (NCBI)