CAS 883543-26-8 appears in our catalog under these names: 2-Fluoro-5-trifluoromethylbenzyl chloride, 98%, 2-(Chloromethyl)-1-fluoro-4-(trifluoromethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g.
2-(chloromethyl)-1-fluoro-4-(trifluoromethyl)benzene (CAS 883543-26-8) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 2-(chloromethyl)-1-fluoro-4-(trifluoromethyl)benzene. InChIKey: OZGWDDBROIXNRQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 2-(chloromethyl)-1-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | OZGWDDBROIXNRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CCl)F |
Computed by PubChem (NCBI)