CAS 1805112-84-8 appears in our catalog under these names: 1-Chloro-2-fluoro-3-methyl-4-(trifluoromethyl)benzene, 95%, 1-Chloro-2-fluoro-3-methyl-4-(trifluoromethyl)benzene, 98%, 1-Chloro-2-fluoro-3-methyl-4-(trifluoromethyl)benzene. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-chloro-2-fluoro-3-methyl-4-(trifluoromethyl)benzene (CAS 1805112-84-8) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 1-chloro-2-fluoro-3-methyl-4-(trifluoromethyl)benzene. InChIKey: YFMYMWZNOPIRMW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 1-chloro-2-fluoro-3-methyl-4-(trifluoromethyl)benzene |
| InChIKey | YFMYMWZNOPIRMW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)