Products 1099660-60-2
CAS 1099660-60-2 appears in our catalog under these names: 2-Bromo-4-nitrobenzenesulphonyl chloride, 2-Bromo-4-nitrobenzenesulphonyl chloride 95%, 2-Bromo-4-nitrobenzenesulphonyl chloride, 95%, 95%, 2-Bromo-4-nitrobenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, Ambeed, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
2-bromo-4-nitrobenzenesulfonyl chloride (CAS 1099660-60-2) is a chemical compound with the molecular formula C6H3BrClNO4S and a molecular weight of 300.51 g/mol. IUPAC name: 2-bromo-4-nitrobenzenesulfonyl chloride. InChIKey: LPFIRAAVBJJUKL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO4S |
|---|---|
| Molecular weight | 300.51 g/mol |
| IUPAC name | 2-bromo-4-nitrobenzenesulfonyl chloride |
| InChIKey | LPFIRAAVBJJUKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-bromo-4-nitrobenzene-1-sulfonyl chloride, 2-Bromo-4-nitrobenzenesulphonyl chloride, 2-bromo-4-nitrobenzenesulfonyl chloride, 2-Bromo-4-nitrobenzenesulphonylchloride, 2-bromo-4-nitro-benzenesulfonyl chloride, 2-Bromo-4-nitro-1-benzenesulfonyl Chloride, Benzenesulfonyl chloride, 2-bromo-4-nitro-