Products 98130-55-3

CAS 98130-55-3 appears in our catalog under these names: 2-Bromo-5-nitrobenzene-1-sulfonyl chloride, 95%, 2–Bromo–5–nitrobenzenesulfonyl chloride, 2-Bromo-5-nitrobenzenesulphonyl chloride, 2-Bromo-5-nitrobenzene-1-sulfonyl chloride 98%, 2-Bromo-5-nitrobenzenesulfonyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-bromo-5-nitrobenzenesulfonyl chloride (CAS 98130-55-3) is a chemical compound with the molecular formula C6H3BrClNO4S and a molecular weight of 300.51 g/mol. IUPAC name: 2-bromo-5-nitrobenzenesulfonyl chloride. InChIKey: OGKGGBNPVRGQQN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrClNO4S
Molecular weight300.51 g/mol
IUPAC name2-bromo-5-nitrobenzenesulfonyl chloride
InChIKeyOGKGGBNPVRGQQN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)