CAS 98130-55-3 appears in our catalog under these names: 2-Bromo-5-nitrobenzene-1-sulfonyl chloride, 95%, 2–Bromo–5–nitrobenzenesulfonyl chloride, 2-Bromo-5-nitrobenzenesulphonyl chloride, 2-Bromo-5-nitrobenzene-1-sulfonyl chloride 98%, 2-Bromo-5-nitrobenzenesulfonyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 5g, 25g.
2-bromo-5-nitrobenzenesulfonyl chloride (CAS 98130-55-3) is a chemical compound with the molecular formula C6H3BrClNO4S and a molecular weight of 300.51 g/mol. IUPAC name: 2-bromo-5-nitrobenzenesulfonyl chloride. InChIKey: OGKGGBNPVRGQQN-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO4S |
|---|---|
| Molecular weight | 300.51 g/mol |
| IUPAC name | 2-bromo-5-nitrobenzenesulfonyl chloride |
| InChIKey | OGKGGBNPVRGQQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)