Products 1261553-98-3

CAS 1261553-98-3 is the registry number for 2-Bromo-3-nitrobenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2-bromo-3-nitrobenzenesulfonyl chloride (CAS 1261553-98-3) is a chemical compound with the molecular formula C6H3BrClNO4S and a molecular weight of 300.51 g/mol. IUPAC name: 2-bromo-3-nitrobenzenesulfonyl chloride. InChIKey: UJRIAWJTBQVISY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrClNO4S
Molecular weight300.51 g/mol
IUPAC name2-bromo-3-nitrobenzenesulfonyl chloride
InChIKeyUJRIAWJTBQVISY-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)S(=O)(=O)Cl)Br)[N+](=O)[O-]

Computed by PubChem (NCBI)