CAS 1261553-98-3 is the registry number for 2-Bromo-3-nitrobenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-bromo-3-nitrobenzenesulfonyl chloride (CAS 1261553-98-3) is a chemical compound with the molecular formula C6H3BrClNO4S and a molecular weight of 300.51 g/mol. IUPAC name: 2-bromo-3-nitrobenzenesulfonyl chloride. InChIKey: UJRIAWJTBQVISY-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO4S |
|---|---|
| Molecular weight | 300.51 g/mol |
| IUPAC name | 2-bromo-3-nitrobenzenesulfonyl chloride |
| InChIKey | UJRIAWJTBQVISY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)