CAS 1261671-62-8 appears in our catalog under these names: 3-bromo-2-nitrobenzenesulfonyl chloride, 95%, 3-Bromo-2-nitrobenzenesulphonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-bromo-2-nitrobenzenesulfonyl chloride (CAS 1261671-62-8) is a chemical compound with the molecular formula C6H3BrClNO4S and a molecular weight of 300.51 g/mol. IUPAC name: 3-bromo-2-nitrobenzenesulfonyl chloride. InChIKey: JDTXKHVLNFSTOC-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO4S |
|---|---|
| Molecular weight | 300.51 g/mol |
| IUPAC name | 3-bromo-2-nitrobenzenesulfonyl chloride |
| InChIKey | JDTXKHVLNFSTOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)