Products 89465-98-5

CAS 89465-98-5 appears in our catalog under these names: 4-Bromo-2-nitrobenzene-1-sulfonyl chloride, 95%, 4-Bromo-2-nitrobenzene-1-sulfonyl chloride, 95+%, 4-Bromo-2-nitrobenzenesulphonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-bromo-2-nitrobenzenesulfonyl chloride (CAS 89465-98-5) is a chemical compound with the molecular formula C6H3BrClNO4S and a molecular weight of 300.51 g/mol. IUPAC name: 4-bromo-2-nitrobenzenesulfonyl chloride. InChIKey: FYVZBWPPMOFMPS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrClNO4S
Molecular weight300.51 g/mol
IUPAC name4-bromo-2-nitrobenzenesulfonyl chloride
InChIKeyFYVZBWPPMOFMPS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)[N+](=O)[O-])S(=O)(=O)Cl

Computed by PubChem (NCBI)