Products 4750-22-5

CAS 4750-22-5 appears in our catalog under these names: 4-Bromo-3-nitrobenzene-1-sulfonyl chloride, 97%, 4-Bromo-3-nitrobenzene-1-sulfonyl chloride, 4-Bromo-3-nitrobenzenesulfonyl Chloride 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-bromo-3-nitrobenzenesulfonyl chloride (CAS 4750-22-5) is a chemical compound with the molecular formula C6H3BrClNO4S and a molecular weight of 300.51 g/mol. IUPAC name: 4-bromo-3-nitrobenzenesulfonyl chloride. InChIKey: OHJQQLFBGSDTEY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrClNO4S
Molecular weight300.51 g/mol
IUPAC name4-bromo-3-nitrobenzenesulfonyl chloride
InChIKeyOHJQQLFBGSDTEY-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])Br

Computed by PubChem (NCBI)