CAS 110064-50-1 appears in our catalog under these names: 7–Hydroxy–3–(4–hydroxybenzylidene)chroman–4–one, 7-Hydroxy-3-(4-hydroxybenzylidene)chroman-4-one. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 10 mg, 5 mg, 1 mg.
(3E)-7-hydroxy-3-[(4-hydroxyphenyl)methylidene]chromen-4-one (CAS 110064-50-1) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: (3E)-7-hydroxy-3-[(4-hydroxyphenyl)methylidene]chromen-4-one. InChIKey: CWFKSHWAQPOKQP-YRNVUSSQSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | (3E)-7-hydroxy-3-[(4-hydroxyphenyl)methylidene]chromen-4-one |
| InChIKey | CWFKSHWAQPOKQP-YRNVUSSQSA-N |
| SMILES | C1/C(=C\C2=CC=C(C=C2)O)/C(=O)C3=C(O1)C=C(C=C3)O |
Computed by PubChem (NCBI)